C18H30O4Si — CID 102587272
(3aS,6Z,9S,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3a,8,9,9a-tetrahydrocycloocta[d][1,3]dioxol-4-one (PubChem CID 102587272) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (3aS,6Z,9S,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3a,8,9,9a-tetrahydrocycloocta[d][1,3]dioxol-4-one.
| Compound Name | (3aS,6Z,9S,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3a,8,9,9a-tetrahydrocycloocta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 102587272 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3aS,6Z,9S,9aR)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3a,8,9,9a-tetrahydrocycloocta[d][1,3]dioxol-4-one |
| SMILES | C=C1/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2C1=O |
| InChI | InChI=1S/C18H30O4Si/c1-12-10-9-11-13(22-23(7,8)17(2,3)4)15-16(14(12)19)21-18(5,6)20-15/h9-10,13,15-16H,1,11H2,2-8H3/b10-9-/t13-,15-,16+/m0/s1 |
| InChIKey | NARWOQRZLTUFLF-LFAGTQEPSA-N |
| XLogP | 3.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|