C23H46O5Si2 — CID 102587846
tert-butyl-[[(1S,2S,4S,6R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-yl]oxy]-dimethylsilane (PubChem CID 102587846) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,4S,6R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,4S,6R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 102587846 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | tert-butyl-[[(1S,2S,4S,6R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-dimethyl-5,10,12-trioxatricyclo[7.3.0.04,6]dodecan-2-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[C@H]1C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O5Si2/c1-21(2,3)29(9,10)27-17-13-15-16(24-15)14-18(28-30(11,12)22(4,5)6)20-19(17)25-23(7,8)26-20/h15-20H,13-14H2,1-12H3/t15-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | WATDXBCGNGGEFN-GNVSMLMZSA-N |
| XLogP | 5.85 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|