C14H26Br2O5 — CID 102587971
2,12-bis(bromomethyl)-2,12-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane (PubChem CID 102587971) has the molecular formula C14H26Br2O5 and a molecular weight of 434.17 g/mol. Its IUPAC name is 2,12-bis(bromomethyl)-2,12-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane.
| Compound Name | 2,12-bis(bromomethyl)-2,12-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane |
|---|---|
| PubChem CID | 102587971 |
| Molecular Formula | C14H26Br2O5 |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2,12-bis(bromomethyl)-2,12-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane |
| SMILES | CC1(CBr)COCCOCCOCC(C)(CBr)OCCO1 |
| InChI | InChI=1S/C14H26Br2O5/c1-13(9-15)11-18-5-3-17-4-6-19-12-14(2,10-16)21-8-7-20-13/h3-12H2,1-2H3 |
| InChIKey | OQAORIBZKYMZTN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|