C20H27NO3 — CID 102587993
methyl (2S,3S,4aS,5S,8aR)-3-hydroxy-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 102587993) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl (2S,3S,4aS,5S,8aR)-3-hydroxy-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S,3S,4aS,5S,8aR)-3-hydroxy-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 102587993 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl (2S,3S,4aS,5S,8aR)-3-hydroxy-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1[C@@H]2CCC[C@@H](/C=C/c3ccccc3)[C@@H]2C[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C20H27NO3/c1-14-19(22)13-17-16(12-11-15-7-4-3-5-8-15)9-6-10-18(17)21(14)20(23)24-2/h3-5,7-8,11-12,14,16-19,22H,6,9-10,13H2,1-2H3/b12-11+/t14-,16-,17-,18+,19-/m0/s1 |
| InChIKey | LWVYKZPYTJXBKV-RIMHHNPOSA-N |
| XLogP | 3.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |