C28H24FNO — CID 102588333
(4aS,5S,10bS)-5-(4-fluorophenyl)-9-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 102588333) has the molecular formula C28H24FNO and a molecular weight of 409.50 g/mol. Its IUPAC name is (4aS,5S,10bS)-5-(4-fluorophenyl)-9-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5S,10bS)-5-(4-fluorophenyl)-9-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 102588333 |
| Molecular Formula | C28H24FNO |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (4aS,5S,10bS)-5-(4-fluorophenyl)-9-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Fc1ccc([C@H]2Nc3ccc(-c4cccc5ccccc45)cc3[C@H]3OCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C28H24FNO/c29-21-13-10-19(11-14-21)27-24-9-4-16-31-28(24)25-17-20(12-15-26(25)30-27)23-8-3-6-18-5-1-2-7-22(18)23/h1-3,5-8,10-15,17,24,27-28,30H,4,9,16H2/t24-,27+,28-/m0/s1 |
| InChIKey | MUSBQQRBVKYFMG-VCTRFXNDSA-N |
| XLogP | 7.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |