C20H14N4O8 — CID 102588597
4-[[6-(1-carboxyethyl)naphthalen-1-yl]diazenyl]-3,5-dinitrobenzoic acid (PubChem CID 102588597) has the molecular formula C20H14N4O8 and a molecular weight of 438.35 g/mol. Its IUPAC name is 4-[[6-(1-carboxyethyl)naphthalen-1-yl]diazenyl]-3,5-dinitrobenzoic acid.
| Compound Name | 4-[[6-(1-carboxyethyl)naphthalen-1-yl]diazenyl]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 102588597 |
| Molecular Formula | C20H14N4O8 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-[[6-(1-carboxyethyl)naphthalen-1-yl]diazenyl]-3,5-dinitrobenzoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(/N=N/c3c([N+](=O)[O-])cc(C(=O)O)cc3[N+](=O)[O-])cccc2c1 |
| InChI | InChI=1S/C20H14N4O8/c1-10(19(25)26)11-5-6-14-12(7-11)3-2-4-15(14)21-22-18-16(23(29)30)8-13(20(27)28)9-17(18)24(31)32/h2-10H,1H3,(H,25,26)(H,27,28)/b22-21+ |
| InChIKey | KGGZQAVVJPGAEI-QURGRASLSA-N |
| XLogP | 4.96 |
| TPSA | 185.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|