About tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate
tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate (PubChem CID 102588732) has the molecular formula C13H21FN2O2
and a molecular weight of 256.32 g/mol. Its IUPAC name is tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate |
| PubChem CID | 102588732 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)/C(F)=C/CC#N |
| InChI | InChI=1S/C13H21FN2O2/c1-9(2)11(10(14)7-6-8-15)16-12(17)18-13(3,4)5/h7,9,11H,6H2,1-5H3,(H,16,17)/b10-7-/t11-/m0/s1 |
| InChIKey | RRHFHFMNHYAJNQ-BRNRAETOSA-N |
| XLogP | 3.30 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate (CID 102588732) is tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate is CC(C)[C@H](NC(=O)OC(C)(C)C)/C(F)=C/CC#N.
What is the InChIKey of tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate?
The InChIKey is RRHFHFMNHYAJNQ-BRNRAETOSA-N. The full InChI is InChI=1S/C13H21FN2O2/c1-9(2)11(10(14)7-6-8-15)16-12(17)18-13(3,4)5/h7,9,11H,6H2,1-5H3,(H,16,17)/b10-7-/t11-/m0/s1.
What are the key properties of tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate?
tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate has a molecular weight of 256.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z,3S)-6-cyano-4-fluoro-2-methylhex-4-en-3-yl]carbamate is sourced from PubChem (CID 102588732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).