C25H44O9Si — CID 102588766
ethyl 2-[(R)-acetyloxy-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate (PubChem CID 102588766) has the molecular formula C25H44O9Si and a molecular weight of 516.70 g/mol. Its IUPAC name is ethyl 2-[(R)-acetyloxy-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(R)-acetyloxy-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102588766 |
| Molecular Formula | C25H44O9Si |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | ethyl 2-[(R)-acetyloxy-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H](OC(C)=O)[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H44O9Si/c1-13-28-22(27)15(2)18(30-16(3)26)20-21(33-25(9,10)32-20)19(17-14-29-24(7,8)31-17)34-35(11,12)23(4,5)6/h17-21H,2,13-14H2,1,3-12H3/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | AJHGMJCPIRZSHU-ONUIULTDSA-N |
| XLogP | 4.10 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|