About 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene]
6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] (PubChem CID 102588930) has the molecular formula C22H32
and a molecular weight of 296.50 g/mol. Its IUPAC name is 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene].
Molecular Properties
| Compound Name | 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] |
| PubChem CID | 102588930 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] |
| SMILES | CCCC1=C(CCC)C2(CCCCCC2)c2cc(C)ccc21 |
| InChI | InChI=1S/C22H32/c1-4-10-18-19-13-12-17(3)16-21(19)22(20(18)11-5-2)14-8-6-7-9-15-22/h12-13,16H,4-11,14-15H2,1-3H3 |
| InChIKey | IATDVLDRQCLLIV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene]?
The IUPAC name of 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] (CID 102588930) is 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene].
What is the SMILES notation for 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene]?
The canonical SMILES for 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] is CCCC1=C(CCC)C2(CCCCCC2)c2cc(C)ccc21.
What is the InChIKey of 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene]?
The InChIKey is IATDVLDRQCLLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32/c1-4-10-18-19-13-12-17(3)16-21(19)22(20(18)11-5-2)14-8-6-7-9-15-22/h12-13,16H,4-11,14-15H2,1-3H3.
What are the key properties of 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene]?
6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] has a molecular weight of 296.50 g/mol, XLogP of 6.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-methyl-2',3'-dipropylspiro[cycloheptane-1,1'-indene] is sourced from PubChem (CID 102588930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).