C15H22N2O2 — CID 102588948
5-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline-6,7-dione (PubChem CID 102588948) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline-6,7-dione.
| Compound Name | 5-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline-6,7-dione |
|---|---|
| PubChem CID | 102588948 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline-6,7-dione |
| SMILES | CC1=C2C(=CC(=O)C1=O)N(C(C)C)CCN2C(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-9(2)16-6-7-17(10(3)4)14-11(5)15(19)13(18)8-12(14)16/h8-10H,6-7H2,1-5H3 |
| InChIKey | BSQGPTNODGDVIN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|