C15H20O3 — CID 102588966
ethyl 3-[(1S,2S,6S,7R)-2-hydroxy-3-tricyclo[5.3.0.02,6]decanylidene]prop-2-enoate (PubChem CID 102588966) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl 3-[(1S,2S,6S,7R)-2-hydroxy-3-tricyclo[5.3.0.02,6]decanylidene]prop-2-enoate.
| Compound Name | ethyl 3-[(1S,2S,6S,7R)-2-hydroxy-3-tricyclo[5.3.0.02,6]decanylidene]prop-2-enoate |
|---|---|
| PubChem CID | 102588966 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl 3-[(1S,2S,6S,7R)-2-hydroxy-3-tricyclo[5.3.0.02,6]decanylidene]prop-2-enoate |
| SMILES | CCOC(=O)C=C=C1CC[C@H]2[C@@H]3CCC[C@@H]3[C@@]12O |
| InChI | InChI=1S/C15H20O3/c1-2-18-14(16)9-7-10-6-8-13-11-4-3-5-12(11)15(10,13)17/h9,11-13,17H,2-6,8H2,1H3/t7?,11-,12+,13+,15+/m1/s1 |
| InChIKey | AQSNHKOJZFZUQB-CTKRLTIJSA-N |
| XLogP | 2.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|