C13H12Br2N2O3 — CID 102589883
5-[(1R,2S)-1,2-dibromo-2-(4-methylphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 102589883) has the molecular formula C13H12Br2N2O3 and a molecular weight of 404.06 g/mol. Its IUPAC name is 5-[(1R,2S)-1,2-dibromo-2-(4-methylphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole.
| Compound Name | 5-[(1R,2S)-1,2-dibromo-2-(4-methylphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 102589883 |
| Molecular Formula | C13H12Br2N2O3 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | 5-[(1R,2S)-1,2-dibromo-2-(4-methylphenyl)ethyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1ccc([C@H](Br)[C@H](Br)c2onc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12Br2N2O3/c1-7-3-5-9(6-4-7)10(14)11(15)13-12(17(18)19)8(2)16-20-13/h3-6,10-11H,1-2H3/t10-,11-/m0/s1 |
| InChIKey | HXQVLDWOMOEVAF-QWRGUYRKSA-N |
| XLogP | 4.77 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|