About 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole
5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 102589889) has the molecular formula C19H16ClN3O3
and a molecular weight of 369.81 g/mol. Its IUPAC name is 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole |
| PubChem CID | 102589889 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1noc([C@@H]2[C@H](c3ccc(Cl)cc3)N2Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16ClN3O3/c1-12-16(23(24)25)19(26-21-12)18-17(14-7-9-15(20)10-8-14)22(18)11-13-5-3-2-4-6-13/h2-10,17-18H,11H2,1H3/t17-,18-,22?/m0/s1 |
| InChIKey | VNTCSFIHBDHGHN-KJMDXERQSA-N |
| XLogP | 4.84 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole?
The IUPAC name of 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole (CID 102589889) is 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole.
What is the SMILES notation for 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole?
The canonical SMILES for 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole is Cc1noc([C@@H]2[C@H](c3ccc(Cl)cc3)N2Cc2ccccc2)c1[N+](=O)[O-].
What is the InChIKey of 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole?
The InChIKey is VNTCSFIHBDHGHN-KJMDXERQSA-N. The full InChI is InChI=1S/C19H16ClN3O3/c1-12-16(23(24)25)19(26-21-12)18-17(14-7-9-15(20)10-8-14)22(18)11-13-5-3-2-4-6-13/h2-10,17-18H,11H2,1H3/t17-,18-,22?/m0/s1.
What are the key properties of 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole?
5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole has a molecular weight of 369.81 g/mol, XLogP of 4.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,3S)-1-benzyl-3-(4-chlorophenyl)aziridin-2-yl]-3-methyl-4-nitro-1,2-oxazole is sourced from PubChem (CID 102589889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).