C30H28S4 — CID 102589937
4,10,19,25-tetrathiatricyclo[26.2.2.213,16]tetratriaconta-1(31),13,15,28(32),29,33-hexaen-2,11,17,26-tetrayne (PubChem CID 102589937) has the molecular formula C30H28S4 and a molecular weight of 516.82 g/mol. Its IUPAC name is 4,10,19,25-tetrathiatricyclo[26.2.2.213,16]tetratriaconta-1(31),13,15,28(32),29,33-hexaen-2,11,17,26-tetrayne.
| Compound Name | 4,10,19,25-tetrathiatricyclo[26.2.2.213,16]tetratriaconta-1(31),13,15,28(32),29,33-hexaen-2,11,17,26-tetrayne |
|---|---|
| PubChem CID | 102589937 |
| Molecular Formula | C30H28S4 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 4,10,19,25-tetrathiatricyclo[26.2.2.213,16]tetratriaconta-1(31),13,15,28(32),29,33-hexaen-2,11,17,26-tetrayne |
| SMILES | C1#Cc2ccc(cc2)C#CSCCCCCSC#Cc2ccc(cc2)C#CSCCCCCS1 |
| InChI | InChI=1S/C30H28S4/c1-3-19-31-23-15-27-7-11-29(12-8-27)17-25-33-21-5-2-6-22-34-26-18-30-13-9-28(10-14-30)16-24-32-20-4-1/h7-14H,1-6,19-22H2 |
| InChIKey | SWPSSIGRMGSLOC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|