C19H24O4Si — CID 102590580
2,2-dimethyl-5-[(1R)-1-(3-methylphenyl)-3-trimethylsilylprop-2-ynyl]-1,3-dioxane-4,6-dione (PubChem CID 102590580) has the molecular formula C19H24O4Si and a molecular weight of 344.48 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(1R)-1-(3-methylphenyl)-3-trimethylsilylprop-2-ynyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(1R)-1-(3-methylphenyl)-3-trimethylsilylprop-2-ynyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102590580 |
| Molecular Formula | C19H24O4Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,2-dimethyl-5-[(1R)-1-(3-methylphenyl)-3-trimethylsilylprop-2-ynyl]-1,3-dioxane-4,6-dione |
| SMILES | Cc1cccc([C@H](C#C[Si](C)(C)C)C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C19H24O4Si/c1-13-8-7-9-14(12-13)15(10-11-24(4,5)6)16-17(20)22-19(2,3)23-18(16)21/h7-9,12,15-16H,1-6H3/t15-/m0/s1 |
| InChIKey | CWIISFLDRMPPTC-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|