C20H30O5 — CID 102590625
3-[(E)-5-[2,4-bis(methoxymethoxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 102590625) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[(E)-5-[2,4-bis(methoxymethoxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(E)-5-[2,4-bis(methoxymethoxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 102590625 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-[(E)-5-[2,4-bis(methoxymethoxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | COCOc1ccc(C/C=C(\C)CCC2OC2(C)C)c(OCOC)c1 |
| InChI | InChI=1S/C20H30O5/c1-15(7-11-19-20(2,3)25-19)6-8-16-9-10-17(23-13-21-4)12-18(16)24-14-22-5/h6,9-10,12,19H,7-8,11,13-14H2,1-5H3/b15-6+ |
| InChIKey | WRPZBPDPHZKMEG-GIDUJCDVSA-N |
| XLogP | 4.10 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|