C21H26N2O5S — CID 102590718
(4R,5S)-4-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 102590718) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (4R,5S)-4-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102590718 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (4R,5S)-4-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)[C@]1(C)NC(=O)O[C@H]1c1ccccc1)[C@@H]3C2 |
| InChI | InChI=1S/C21H26N2O5S/c1-19(2)14-9-10-21(19)12-29(26,27)23(15(21)11-14)17(24)20(3)16(28-18(25)22-20)13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3,(H,22,25)/t14-,15-,16+,20-,21-/m1/s1 |
| InChIKey | YLUHFNCUZSUWQK-LAUMKVMGSA-N |
| XLogP | 2.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |