C30H27ClN3O2+ — CID 102590744
(E)-3-(4-chlorophenyl)-1-[(1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaen-3-yl]prop-2-en-1-one (PubChem CID 102590744) has the molecular formula C30H27ClN3O2+ and a molecular weight of 497.02 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[(1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaen-3-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[(1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaen-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102590744 |
| Molecular Formula | C30H27ClN3O2+ |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[(1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaen-3-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C)c(-n2nc3[n+](c2C(=O)/C=C/c2ccc(Cl)cc2)[C@@H]2c4ccccc4C[C@@H]2OC3)c(C)c1 |
| InChI | InChI=1S/C30H27ClN3O2/c1-18-14-19(2)28(20(3)15-18)34-30(25(35)13-10-21-8-11-23(31)12-9-21)33-27(32-34)17-36-26-16-22-6-4-5-7-24(22)29(26)33/h4-15,26,29H,16-17H2,1-3H3/q+1/b13-10+/t26-,29+/m0/s1 |
| InChIKey | RPAUMBSPTXGZEB-OSHSGXIVSA-N |
| XLogP | 5.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|