C14H15NO4 — CID 102590756
3-(4-nitrophenyl)-3-prop-2-enylpentane-2,4-dione (PubChem CID 102590756) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-3-prop-2-enylpentane-2,4-dione.
| Compound Name | 3-(4-nitrophenyl)-3-prop-2-enylpentane-2,4-dione |
|---|---|
| PubChem CID | 102590756 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-(4-nitrophenyl)-3-prop-2-enylpentane-2,4-dione |
| SMILES | C=CCC(C(C)=O)(C(C)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15NO4/c1-4-9-14(10(2)16,11(3)17)12-5-7-13(8-6-12)15(18)19/h4-8H,1,9H2,2-3H3 |
| InChIKey | BRQDKJCKJZLQHC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|