C15H21N4+ — CID 102590758
[(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methanamine (PubChem CID 102590758) has the molecular formula C15H21N4+ and a molecular weight of 257.36 g/mol. Its IUPAC name is [(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methanamine.
| Compound Name | [(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 102590758 |
| Molecular Formula | C15H21N4+ |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methanamine |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CC[C@H]3CN)c(C)c1 |
| InChI | InChI=1S/C15H21N4/c1-10-6-11(2)15(12(3)7-10)19-9-18-13(8-16)4-5-14(18)17-19/h6-7,9,13H,4-5,8,16H2,1-3H3/q+1/t13-/m0/s1 |
| InChIKey | VRVAYIICGCJMPS-ZDUSSCGKSA-N |
| XLogP | 1.53 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|