About trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate
trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate (PubChem CID 102590880) has the molecular formula C14H15FO4
and a molecular weight of 266.27 g/mol. Its IUPAC name is trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate |
| PubChem CID | 102590880 |
| Molecular Formula | C14H15FO4 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@]1(F)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15FO4/c1-2-18-13(17)14(15)8-11(14)12(16)19-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-,14+/m1/s1 |
| InChIKey | JBMLKOGZHPAWRN-RISCZKNCSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The IUPAC name of trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate (CID 102590880) is trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate.
What is the SMILES notation for trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The canonical SMILES for trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate is CCOC(=O)[C@]1(F)C[C@@H]1C(=O)OCc1ccccc1.
What is the InChIKey of trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The InChIKey is JBMLKOGZHPAWRN-RISCZKNCSA-N. The full InChI is InChI=1S/C14H15FO4/c1-2-18-13(17)14(15)8-11(14)12(16)19-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-,14+/m1/s1.
What are the key properties of trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate has a molecular weight of 266.27 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-2-O-benzyl 1-O-ethyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate is sourced from PubChem (CID 102590880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).