About ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate
ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 102591088) has the molecular formula C16H20N2O6
and a molecular weight of 336.34 g/mol. Its IUPAC name is ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
Molecular Properties
| Compound Name | ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| PubChem CID | 102591088 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCOC(=O)[C@@H](NC(=O)OC(C)(C)C)c1nc2cc(O)ccc2o1 |
| InChI | InChI=1S/C16H20N2O6/c1-5-22-14(20)12(18-15(21)24-16(2,3)4)13-17-10-8-9(19)6-7-11(10)23-13/h6-8,12,19H,5H2,1-4H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | QQRXEUZITLAXKC-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The IUPAC name of ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CID 102591088) is ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
What is the SMILES notation for ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The canonical SMILES for ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is CCOC(=O)[C@@H](NC(=O)OC(C)(C)C)c1nc2cc(O)ccc2o1.
What is the InChIKey of ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The InChIKey is QQRXEUZITLAXKC-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H20N2O6/c1-5-22-14(20)12(18-15(21)24-16(2,3)4)13-17-10-8-9(19)6-7-11(10)23-13/h6-8,12,19H,5H2,1-4H3,(H,18,21)/t12-/m0/s1.
What are the key properties of ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate has a molecular weight of 336.34 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-(5-hydroxy-1,3-benzoxazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is sourced from PubChem (CID 102591088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).