C16H27N — CID 102591752
2-ethyl-1,3-dipropyl-4,5,6,7-tetrahydroisoindole (PubChem CID 102591752) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-ethyl-1,3-dipropyl-4,5,6,7-tetrahydroisoindole.
| Compound Name | 2-ethyl-1,3-dipropyl-4,5,6,7-tetrahydroisoindole |
|---|---|
| PubChem CID | 102591752 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-ethyl-1,3-dipropyl-4,5,6,7-tetrahydroisoindole |
| SMILES | CCCc1c2c(c(CCC)n1CC)CCCC2 |
| InChI | InChI=1S/C16H27N/c1-4-9-15-13-11-7-8-12-14(13)16(10-5-2)17(15)6-3/h4-12H2,1-3H3 |
| InChIKey | IVNWAMQXRNNGHS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |