C11H12N3O+ — CID 102591883
2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 102591883) has the molecular formula C11H12N3O+ and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | 2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 102591883 |
| Molecular Formula | C11H12N3O+ |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | c1ccc(-n2c[n+]3c(n2)COCC3)cc1 |
| InChI | InChI=1S/C11H12N3O/c1-2-4-10(5-3-1)14-9-13-6-7-15-8-11(13)12-14/h1-5,9H,6-8H2/q+1 |
| InChIKey | ZQZSGTKVFDODAX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|