C12H15NO — CID 102592002
(4aR,8aR)-6-methyl-4-oxo-1,2,3,5,8,8a-hexahydronaphthalene-4a-carbonitrile (PubChem CID 102592002) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (4aR,8aR)-6-methyl-4-oxo-1,2,3,5,8,8a-hexahydronaphthalene-4a-carbonitrile.
| Compound Name | (4aR,8aR)-6-methyl-4-oxo-1,2,3,5,8,8a-hexahydronaphthalene-4a-carbonitrile |
|---|---|
| PubChem CID | 102592002 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (4aR,8aR)-6-methyl-4-oxo-1,2,3,5,8,8a-hexahydronaphthalene-4a-carbonitrile |
| SMILES | CC1=CC[C@H]2CCCC(=O)[C@]2(C#N)C1 |
| InChI | InChI=1S/C12H15NO/c1-9-5-6-10-3-2-4-11(14)12(10,7-9)8-13/h5,10H,2-4,6-7H2,1H3/t10-,12+/m1/s1 |
| InChIKey | VODUQOIUWRUVEM-PWSUYJOCSA-N |
| XLogP | 2.61 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|