C44H52Cl4Si2 — CID 102592233
dichloro-[2-[8-[2-[dichloro-[2,4,6-tri(propan-2-yl)phenyl]silyl]ethynyl]naphthalen-1-yl]ethynyl]-[2,4,6-tri(propan-2-yl)phenyl]silane (PubChem CID 102592233) has the molecular formula C44H52Cl4Si2 and a molecular weight of 778.88 g/mol. Its IUPAC name is dichloro-[2-[8-[2-[dichloro-[2,4,6-tri(propan-2-yl)phenyl]silyl]ethynyl]naphthalen-1-yl]ethynyl]-[2,4,6-tri(propan-2-yl)phenyl]silane.
| Compound Name | dichloro-[2-[8-[2-[dichloro-[2,4,6-tri(propan-2-yl)phenyl]silyl]ethynyl]naphthalen-1-yl]ethynyl]-[2,4,6-tri(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 102592233 |
| Molecular Formula | C44H52Cl4Si2 |
| Molecular Weight | 778.88 g/mol |
| Exact Mass | 776.24 |
| IUPAC Name | dichloro-[2-[8-[2-[dichloro-[2,4,6-tri(propan-2-yl)phenyl]silyl]ethynyl]naphthalen-1-yl]ethynyl]-[2,4,6-tri(propan-2-yl)phenyl]silane |
| SMILES | CC(C)c1cc(C(C)C)c([Si](Cl)(Cl)C#Cc2cccc3cccc(C#C[Si](Cl)(Cl)c4c(C(C)C)cc(C(C)C)cc4C(C)C)c23)c(C(C)C)c1 |
| InChI | InChI=1S/C44H52Cl4Si2/c1-27(2)36-23-38(29(5)6)43(39(24-36)30(7)8)49(45,46)21-19-34-17-13-15-33-16-14-18-35(42(33)34)20-22-50(47,48)44-40(31(9)10)25-37(28(3)4)26-41(44)32(11)12/h13-18,23-32H,1-12H3 |
| InChIKey | JPAKYILQIOKYLZ-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.88 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|