C22H23NO5S — CID 102592394
1-[2-methyl-3-[(E)-3-naphthalen-2-yloxy-3-oxoprop-1-enyl]sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 102592394) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-[2-methyl-3-[(E)-3-naphthalen-2-yloxy-3-oxoprop-1-enyl]sulfanylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-methyl-3-[(E)-3-naphthalen-2-yloxy-3-oxoprop-1-enyl]sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102592394 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[2-methyl-3-[(E)-3-naphthalen-2-yloxy-3-oxoprop-1-enyl]sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(CS/C=C/C(=O)Oc1ccc2ccccc2c1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H23NO5S/c1-15(21(25)23-11-4-7-19(23)22(26)27)14-29-12-10-20(24)28-18-9-8-16-5-2-3-6-17(16)13-18/h2-3,5-6,8-10,12-13,15,19H,4,7,11,14H2,1H3,(H,26,27)/b12-10+ |
| InChIKey | VUZIDLUZDCBPRP-ZRDIBKRKSA-N |
| XLogP | 3.70 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|