C18H22O2 — CID 102593052
butyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)prop-2-enoate (PubChem CID 102593052) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is butyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)prop-2-enoate.
| Compound Name | butyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)prop-2-enoate |
|---|---|
| PubChem CID | 102593052 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | butyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/C1CC2CC1c1ccccc12 |
| InChI | InChI=1S/C18H22O2/c1-2-3-10-20-18(19)9-8-13-11-14-12-17(13)16-7-5-4-6-15(14)16/h4-9,13-14,17H,2-3,10-12H2,1H3/b9-8+ |
| InChIKey | USSHVIFSNOQYNA-CMDGGOBGSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|