C17H20O2 — CID 102593058
ethyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)but-2-enoate (PubChem CID 102593058) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is ethyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)but-2-enoate.
| Compound Name | ethyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)but-2-enoate |
|---|---|
| PubChem CID | 102593058 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | ethyl (E)-3-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)C1CC2CC1c1ccccc12 |
| InChI | InChI=1S/C17H20O2/c1-3-19-17(18)8-11(2)15-9-12-10-16(15)14-7-5-4-6-13(12)14/h4-8,12,15-16H,3,9-10H2,1-2H3/b11-8+ |
| InChIKey | DWWXXMQVXOKNTG-DHZHZOJOSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|