C12H19N3O2 — CID 102593143
(2S,3S,7S)-N-tert-butyl-6-oxo-1,5-diazatricyclo[5.2.0.03,5]nonane-2-carboxamide (PubChem CID 102593143) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S,3S,7S)-N-tert-butyl-6-oxo-1,5-diazatricyclo[5.2.0.03,5]nonane-2-carboxamide.
| Compound Name | (2S,3S,7S)-N-tert-butyl-6-oxo-1,5-diazatricyclo[5.2.0.03,5]nonane-2-carboxamide |
|---|---|
| PubChem CID | 102593143 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2S,3S,7S)-N-tert-butyl-6-oxo-1,5-diazatricyclo[5.2.0.03,5]nonane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1[C@@H]2CN2C(=O)[C@@H]2CCN12 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)13-10(16)9-8-6-15(8)11(17)7-4-5-14(7)9/h7-9H,4-6H2,1-3H3,(H,13,16)/t7-,8-,9-,15?/m0/s1 |
| InChIKey | GDGNZDRKBBKKSP-IWIYHGTRSA-N |
| XLogP | -0.43 |
| TPSA | 52.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|