C15H26O3 — CID 102593472
(E,10S)-10-hydroxy-6,10-dimethyltridec-6-ene-2,12-dione (PubChem CID 102593472) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (E,10S)-10-hydroxy-6,10-dimethyltridec-6-ene-2,12-dione.
| Compound Name | (E,10S)-10-hydroxy-6,10-dimethyltridec-6-ene-2,12-dione |
|---|---|
| PubChem CID | 102593472 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (E,10S)-10-hydroxy-6,10-dimethyltridec-6-ene-2,12-dione |
| SMILES | CC(=O)CCC/C(C)=C/CC[C@](C)(O)CC(C)=O |
| InChI | InChI=1S/C15H26O3/c1-12(7-5-9-13(2)16)8-6-10-15(4,18)11-14(3)17/h8,18H,5-7,9-11H2,1-4H3/b12-8+/t15-/m0/s1 |
| InChIKey | GTXUPRXWCSHMFU-JQVXPOPVSA-N |
| XLogP | 3.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|