C12H13BrO5 — CID 102593693
dimethyl (1R,2R,3R,4R)-1-bromo-5,6-dimethylidene-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 102593693) has the molecular formula C12H13BrO5 and a molecular weight of 317.14 g/mol. Its IUPAC name is dimethyl (1R,2R,3R,4R)-1-bromo-5,6-dimethylidene-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3R,4R)-1-bromo-5,6-dimethylidene-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102593693 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | dimethyl (1R,2R,3R,4R)-1-bromo-5,6-dimethylidene-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | C=C1C(=C)[C@@]2(Br)O[C@@H]1[C@H](C(=O)OC)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C12H13BrO5/c1-5-6(2)12(13)8(11(15)17-4)7(9(5)18-12)10(14)16-3/h7-9H,1-2H2,3-4H3/t7-,8-,9+,12-/m1/s1 |
| InChIKey | RLBPMOCBCFEJDZ-KZFFXBSXSA-N |
| XLogP | 1.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|