C29H36F3N5O6S4 — CID 10259412
4-[3-[2-methyl-4-[[N'-(6-methylsulfonylhexyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 10259412) has the molecular formula C29H36F3N5O6S4 and a molecular weight of 735.90 g/mol. Its IUPAC name is 4-[3-[2-methyl-4-[[N'-(6-methylsulfonylhexyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-[2-methyl-4-[[N'-(6-methylsulfonylhexyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10259412 |
| Molecular Formula | C29H36F3N5O6S4 |
| Molecular Weight | 735.90 g/mol |
| Exact Mass | 735.15 |
| IUPAC Name | 4-[3-[2-methyl-4-[[N'-(6-methylsulfonylhexyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3ccc(N/C(N)=N/CCCCCCS(C)(=O)=O)cc3C)c2)c(SC)s1 |
| InChI | InChI=1S/C27H35N5O4S4.C2HF3O2/c1-18-15-20(32-27(30)31-13-6-4-5-7-14-39(3,33)34)11-12-22(18)19-9-8-10-21(16-19)40(35,36)24-17-23(25(28)29)38-26(24)37-2;3-2(4,5)1(6)7/h8-12,15-17H,4-7,13-14H2,1-3H3,(H3,28,29)(H3,30,31,32);(H,6,7) |
| InChIKey | RHCQKAINXNIPEA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 205.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|