About (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one
(E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one (PubChem CID 102594206) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one.
Molecular Properties
| Compound Name | (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one |
| PubChem CID | 102594206 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one |
| SMILES | C/C(=C\C(C)(C)C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H21NO2/c1-10(9-12(2,3)4)11(14)13-5-7-15-8-6-13/h9H,5-8H2,1-4H3/b10-9+ |
| InChIKey | AFXCMZAWQCQVJT-MDZDMXLPSA-N |
| XLogP | 1.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one?
The IUPAC name of (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one (CID 102594206) is (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one.
What is the SMILES notation for (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one?
The canonical SMILES for (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one is C/C(=C\C(C)(C)C)C(=O)N1CCOCC1.
What is the InChIKey of (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one?
The InChIKey is AFXCMZAWQCQVJT-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H21NO2/c1-10(9-12(2,3)4)11(14)13-5-7-15-8-6-13/h9H,5-8H2,1-4H3/b10-9+.
What are the key properties of (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one?
(E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one has a molecular weight of 211.30 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4,4-trimethyl-1-morpholin-4-ylpent-2-en-1-one is sourced from PubChem (CID 102594206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).