C9H11BrN2 — CID 102594452
4-bromo-5,6,7,8-tetrahydroisoquinolin-1-amine (PubChem CID 102594452) has the molecular formula C9H11BrN2 and a molecular weight of 227.10 g/mol. Its IUPAC name is 4-bromo-5,6,7,8-tetrahydroisoquinolin-1-amine.
| Compound Name | 4-bromo-5,6,7,8-tetrahydroisoquinolin-1-amine |
|---|---|
| PubChem CID | 102594452 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 4-bromo-5,6,7,8-tetrahydroisoquinolin-1-amine |
| SMILES | Nc1ncc(Br)c2c1CCCC2 |
| InChI | InChI=1S/C9H11BrN2/c10-8-5-12-9(11)7-4-2-1-3-6(7)8/h5H,1-4H2,(H2,11,12) |
| InChIKey | QZTPSDMYQGRZGI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |