C62H52N6O — CID 102595040
5-[4-[4-[4-(1-butyl-4-pyridinylidene)-1-pyridinyl]butoxy]phenyl]-10,15,20-triphenylporphyrin (PubChem CID 102595040) has the molecular formula C62H52N6O and a molecular weight of 897.14 g/mol. Its IUPAC name is 5-[4-[4-[4-(1-butyl-4-pyridinylidene)-1-pyridinyl]butoxy]phenyl]-10,15,20-triphenylporphyrin.
| Compound Name | 5-[4-[4-[4-(1-butyl-4-pyridinylidene)-1-pyridinyl]butoxy]phenyl]-10,15,20-triphenylporphyrin |
|---|---|
| PubChem CID | 102595040 |
| Molecular Formula | C62H52N6O |
| Molecular Weight | 897.14 g/mol |
| Exact Mass | 896.42 |
| IUPAC Name | 5-[4-[4-[4-(1-butyl-4-pyridinylidene)-1-pyridinyl]butoxy]phenyl]-10,15,20-triphenylporphyrin |
| SMILES | CCCCN1C=CC(=C2C=CN(CCCCOc3ccc(/C4=C5\C=CC(=N5)/C(c5ccccc5)=C5/C=CC(=N5)/C(c5ccccc5)=C5/C=CC(=N5)/C(c5ccccc5)=C5/C=CC4=N5)cc3)C=C2)C=C1 |
| InChI | InChI=1S/C62H52N6O/c1-2-3-37-67-39-33-44(34-40-67)45-35-41-68(42-36-45)38-13-14-43-69-50-23-21-49(22-24-50)62-57-31-29-55(65-57)60(47-17-9-5-10-18-47)53-27-25-51(63-53)59(46-15-7-4-8-16-46)52-26-28-54(64-52)61(48-19-11-6-12-20-48)56-30-32-58(62)66-56/h4-12,15-36,39-42H,2-3,13-14,37-38,43H2,1H3/b59-51-,59-52-,60-53-,60-55-,61-54-,61-56-,62-57-,62-58- |
| InChIKey | ODEUFAGGSWDRMS-CKYGRQDQSA-N |
| XLogP | 13.63 |
| TPSA | 65.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.14 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|