C20H24N2O4S — CID 102595406
ethyl 4-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-2-diazo-3-oxobutanoate (PubChem CID 102595406) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is ethyl 4-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-2-diazo-3-oxobutanoate.
| Compound Name | ethyl 4-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-2-diazo-3-oxobutanoate |
|---|---|
| PubChem CID | 102595406 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | ethyl 4-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-2-diazo-3-oxobutanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)C[C@@]12CCC[C@@H]1C[C@@H](Sc1ccc(C)cc1)O2 |
| InChI | InChI=1S/C20H24N2O4S/c1-3-25-19(24)18(22-21)16(23)12-20-10-4-5-14(20)11-17(26-20)27-15-8-6-13(2)7-9-15/h6-9,14,17H,3-5,10-12H2,1-2H3/t14-,17-,20+/m1/s1 |
| InChIKey | VLILHNZLHKCJSD-ZTQAJYAQSA-N |
| XLogP | 3.57 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|