C12H13NO2 — CID 102595691
(2R,7aR)-2-phenyl-5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-3-one (PubChem CID 102595691) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2R,7aR)-2-phenyl-5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-3-one.
| Compound Name | (2R,7aR)-2-phenyl-5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 102595691 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2R,7aR)-2-phenyl-5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazol-3-one |
| SMILES | O=C1[C@@H](c2ccccc2)O[C@@H]2CCCN12 |
| InChI | InChI=1S/C12H13NO2/c14-12-11(9-5-2-1-3-6-9)15-10-7-4-8-13(10)12/h1-3,5-6,10-11H,4,7-8H2/t10-,11-/m1/s1 |
| InChIKey | RJKZHMSWICFFAD-GHMZBOCLSA-N |
| XLogP | 1.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |