About triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane
triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane (PubChem CID 102595887) has the molecular formula C17H30OSi
and a molecular weight of 278.51 g/mol. Its IUPAC name is triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane |
| PubChem CID | 102595887 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane |
| SMILES | C#CC[C@H]1CCC[C@]1(O[Si](CC)(CC)CC)C(=C)C |
| InChI | InChI=1S/C17H30OSi/c1-7-12-16-13-11-14-17(16,15(5)6)18-19(8-2,9-3)10-4/h1,16H,5,8-14H2,2-4,6H3/t16-,17-/m0/s1 |
| InChIKey | VSJHDLBCJRSSJP-IRXDYDNUSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane?
The IUPAC name of triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane (CID 102595887) is triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane.
What is the SMILES notation for triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane?
The canonical SMILES for triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane is C#CC[C@H]1CCC[C@]1(O[Si](CC)(CC)CC)C(=C)C.
What is the InChIKey of triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane?
The InChIKey is VSJHDLBCJRSSJP-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H30OSi/c1-7-12-16-13-11-14-17(16,15(5)6)18-19(8-2,9-3)10-4/h1,16H,5,8-14H2,2-4,6H3/t16-,17-/m0/s1.
What are the key properties of triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane?
triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane has a molecular weight of 278.51 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1R,2R)-1-prop-1-en-2-yl-2-prop-2-ynylcyclopentyl]oxysilane is sourced from PubChem (CID 102595887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).