C24H42O6Si — CID 102595990
[(1R,2R,4Z,6S,7S,8R,9S,13S)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-13-methoxy-4,11,11-trimethyl-12-oxatricyclo[6.3.2.01,9]tridec-4-en-2-yl] acetate (PubChem CID 102595990) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is [(1R,2R,4Z,6S,7S,8R,9S,13S)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-13-methoxy-4,11,11-trimethyl-12-oxatricyclo[6.3.2.01,9]tridec-4-en-2-yl] acetate.
| Compound Name | [(1R,2R,4Z,6S,7S,8R,9S,13S)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-13-methoxy-4,11,11-trimethyl-12-oxatricyclo[6.3.2.01,9]tridec-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 102595990 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | [(1R,2R,4Z,6S,7S,8R,9S,13S)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-13-methoxy-4,11,11-trimethyl-12-oxatricyclo[6.3.2.01,9]tridec-4-en-2-yl] acetate |
| SMILES | CO[C@H]1O[C@]23[C@H](OC(C)=O)C/C(C)=C\[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H]2CC3(C)C |
| InChI | InChI=1S/C24H42O6Si/c1-14-11-17(26)20(30-31(9,10)22(3,4)5)19-16-13-23(6,7)24(16,29-21(19)27-8)18(12-14)28-15(2)25/h11,16-21,26H,12-13H2,1-10H3/b14-11-/t16-,17-,18+,19+,20+,21-,24-/m0/s1 |
| InChIKey | BCQVSGLPIASHAW-XVPNISBDSA-N |
| XLogP | 4.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|