About octan-2-yl 4-acetamidobenzoate
octan-2-yl 4-acetamidobenzoate (PubChem CID 102596170) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is octan-2-yl 4-acetamidobenzoate.
Molecular Properties
| Compound Name | octan-2-yl 4-acetamidobenzoate |
| PubChem CID | 102596170 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | octan-2-yl 4-acetamidobenzoate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-5-6-7-8-13(2)21-17(20)15-9-11-16(12-10-15)18-14(3)19/h9-13H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | JRUJGIUHTNWISB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 4-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 4-acetamidobenzoate?
The IUPAC name of octan-2-yl 4-acetamidobenzoate (CID 102596170) is octan-2-yl 4-acetamidobenzoate.
What is the SMILES notation for octan-2-yl 4-acetamidobenzoate?
The canonical SMILES for octan-2-yl 4-acetamidobenzoate is CCCCCCC(C)OC(=O)c1ccc(NC(C)=O)cc1.
What is the InChIKey of octan-2-yl 4-acetamidobenzoate?
The InChIKey is JRUJGIUHTNWISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-4-5-6-7-8-13(2)21-17(20)15-9-11-16(12-10-15)18-14(3)19/h9-13H,4-8H2,1-3H3,(H,18,19).
What are the key properties of octan-2-yl 4-acetamidobenzoate?
octan-2-yl 4-acetamidobenzoate has a molecular weight of 291.39 g/mol, XLogP of 4.16, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 4-acetamidobenzoate is sourced from PubChem (CID 102596170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).