C19H20N2O6 — CID 102596260
dimethyl 2-(tert-butyliminomethylidene)-3-(1,3-dioxoisoindol-2-yl)butanedioate (PubChem CID 102596260) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is dimethyl 2-(tert-butyliminomethylidene)-3-(1,3-dioxoisoindol-2-yl)butanedioate.
| Compound Name | dimethyl 2-(tert-butyliminomethylidene)-3-(1,3-dioxoisoindol-2-yl)butanedioate |
|---|---|
| PubChem CID | 102596260 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | dimethyl 2-(tert-butyliminomethylidene)-3-(1,3-dioxoisoindol-2-yl)butanedioate |
| SMILES | COC(=O)C(=C=NC(C)(C)C)C(C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H20N2O6/c1-19(2,3)20-10-13(17(24)26-4)14(18(25)27-5)21-15(22)11-8-6-7-9-12(11)16(21)23/h6-9,14H,1-5H3 |
| InChIKey | GSXFUVFDEHKWGD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|