About 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline
6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline (PubChem CID 102596393) has the molecular formula C16H21N3
and a molecular weight of 255.37 g/mol. Its IUPAC name is 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline.
Molecular Properties
| Compound Name | 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline |
| PubChem CID | 102596393 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline |
| SMILES | CN1CCCN(Cc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C16H21N3/c1-18-8-3-9-19(11-10-18)13-14-5-6-16-15(12-14)4-2-7-17-16/h2,4-7,12H,3,8-11,13H2,1H3 |
| InChIKey | DIQRHBUDTKMUNJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline?
The IUPAC name of 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline (CID 102596393) is 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline.
What is the SMILES notation for 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline?
The canonical SMILES for 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline is CN1CCCN(Cc2ccc3ncccc3c2)CC1.
What is the InChIKey of 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline?
The InChIKey is DIQRHBUDTKMUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3/c1-18-8-3-9-19(11-10-18)13-14-5-6-16-15(12-14)4-2-7-17-16/h2,4-7,12H,3,8-11,13H2,1H3.
What are the key properties of 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline?
6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline has a molecular weight of 255.37 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-methyl-1,4-diazepan-1-yl)methyl]quinoline is sourced from PubChem (CID 102596393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).