About (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate
(2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate (PubChem CID 102596545) has the molecular formula C5H5FO5
and a molecular weight of 164.09 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate |
| PubChem CID | 102596545 |
| Molecular Formula | C5H5FO5 |
| Molecular Weight | 164.09 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate |
| SMILES | O=C(F)OCC1COC(=O)O1 |
| InChI | InChI=1S/C5H5FO5/c6-4(7)9-1-3-2-10-5(8)11-3/h3H,1-2H2 |
| InChIKey | BPFIXYPATJUZGP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate (CID 102596545) is (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate is O=C(F)OCC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate?
The InChIKey is BPFIXYPATJUZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FO5/c6-4(7)9-1-3-2-10-5(8)11-3/h3H,1-2H2.
What are the key properties of (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate?
(2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate has a molecular weight of 164.09 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl)methyl carbonofluoridate is sourced from PubChem (CID 102596545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).