C51H35BF2N2 — CID 102596632
2,2-difluoro-4,5,6,8,10,11,12-heptakis-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 102596632) has the molecular formula C51H35BF2N2 and a molecular weight of 724.66 g/mol. Its IUPAC name is 2,2-difluoro-4,5,6,8,10,11,12-heptakis-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,5,6,8,10,11,12-heptakis-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 102596632 |
| Molecular Formula | C51H35BF2N2 |
| Molecular Weight | 724.66 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | 2,2-difluoro-4,5,6,8,10,11,12-heptakis-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)C(c2ccccc2)=C2C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C51H35BF2N2/c53-52(54)55-48(41-32-18-6-19-33-41)43(36-22-8-1-9-23-36)45(38-26-12-3-13-27-38)50(55)47(40-30-16-5-17-31-40)51-46(39-28-14-4-15-29-39)44(37-24-10-2-11-25-37)49(56(51)52)42-34-20-7-21-35-42/h1-35H |
| InChIKey | YTJXLYOTVRIDAX-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.66 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|