C35H54 — CID 102596711
(1S,4aR,4bR,6aS,10aS,10bR,12aR)-4b,7,7,10a,12a-pentamethyl-2-methylidene-1-[(3R)-3-(4-methylphenyl)butyl]-3,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydro-1H-chrysene (PubChem CID 102596711) has the molecular formula C35H54 and a molecular weight of 474.82 g/mol. Its IUPAC name is (1S,4aR,4bR,6aS,10aS,10bR,12aR)-4b,7,7,10a,12a-pentamethyl-2-methylidene-1-[(3R)-3-(4-methylphenyl)butyl]-3,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydro-1H-chrysene.
| Compound Name | (1S,4aR,4bR,6aS,10aS,10bR,12aR)-4b,7,7,10a,12a-pentamethyl-2-methylidene-1-[(3R)-3-(4-methylphenyl)butyl]-3,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydro-1H-chrysene |
|---|---|
| PubChem CID | 102596711 |
| Molecular Formula | C35H54 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.42 |
| IUPAC Name | (1S,4aR,4bR,6aS,10aS,10bR,12aR)-4b,7,7,10a,12a-pentamethyl-2-methylidene-1-[(3R)-3-(4-methylphenyl)butyl]-3,4,4a,5,6,6a,8,9,10,10b,11,12-dodecahydro-1H-chrysene |
| SMILES | C=C1CC[C@H]2[C@]3(C)CC[C@H]4C(C)(C)CCC[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1CC[C@@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H54/c1-24-10-14-27(15-11-24)25(2)12-16-28-26(3)13-17-30-33(28,6)22-19-31-34(7)21-9-20-32(4,5)29(34)18-23-35(30,31)8/h10-11,14-15,25,28-31H,3,9,12-13,16-23H2,1-2,4-8H3/t25-,28+,29+,30-,31-,33-,34+,35+/m1/s1 |
| InChIKey | ZRZKSUXNULZPHV-ATJBQKKCSA-N |
| XLogP | 10.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|