C6H9FO2 — CID 102597202
3-fluoro-4,4-dimethyloxolan-2-one (PubChem CID 102597202) has the molecular formula C6H9FO2 and a molecular weight of 132.13 g/mol. Its IUPAC name is 3-fluoro-4,4-dimethyloxolan-2-one.
| Compound Name | 3-fluoro-4,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102597202 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 3-fluoro-4,4-dimethyloxolan-2-one |
| SMILES | CC1(C)COC(=O)C1F |
| InChI | InChI=1S/C6H9FO2/c1-6(2)3-9-5(8)4(6)7/h4H,3H2,1-2H3 |
| InChIKey | XRTLCHKDNFCZQD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |