C17H17NO3S — CID 102597370
(2R,3S,4S,5R)-2-methyl-4-nitro-3-phenyl-5-thiophen-2-ylcyclohexan-1-one (PubChem CID 102597370) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-methyl-4-nitro-3-phenyl-5-thiophen-2-ylcyclohexan-1-one.
| Compound Name | (2R,3S,4S,5R)-2-methyl-4-nitro-3-phenyl-5-thiophen-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 102597370 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2R,3S,4S,5R)-2-methyl-4-nitro-3-phenyl-5-thiophen-2-ylcyclohexan-1-one |
| SMILES | C[C@H]1C(=O)C[C@@H](c2cccs2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO3S/c1-11-14(19)10-13(15-8-5-9-22-15)17(18(20)21)16(11)12-6-3-2-4-7-12/h2-9,11,13,16-17H,10H2,1H3/t11-,13-,16-,17+/m0/s1 |
| InChIKey | WXXMHGPZMJZPFC-WGGXSYPISA-N |
| XLogP | 3.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|