About diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate
diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate (PubChem CID 102597805) has the molecular formula C19H34O5Si
and a molecular weight of 370.56 g/mol. Its IUPAC name is diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate.
Molecular Properties
| Compound Name | diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate |
| PubChem CID | 102597805 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate |
| SMILES | CCOC(=O)/C=C\CC(C/C=C\C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O5Si/c1-8-22-17(20)14-10-12-16(13-11-15-18(21)23-9-2)24-25(6,7)19(3,4)5/h10-11,14-16H,8-9,12-13H2,1-7H3/b14-10-,15-11- |
| InChIKey | VKOILVQXNRLMAM-HYQBVQLESA-N |
| XLogP | 4.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate?
The IUPAC name of diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate (CID 102597805) is diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate.
What is the SMILES notation for diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate?
The canonical SMILES for diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate is CCOC(=O)/C=C\CC(C/C=C\C(=O)OCC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate?
The InChIKey is VKOILVQXNRLMAM-HYQBVQLESA-N. The full InChI is InChI=1S/C19H34O5Si/c1-8-22-17(20)14-10-12-16(13-11-15-18(21)23-9-2)24-25(6,7)19(3,4)5/h10-11,14-16H,8-9,12-13H2,1-7H3/b14-10-,15-11-.
What are the key properties of diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate?
diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate has a molecular weight of 370.56 g/mol, XLogP of 4.40, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2Z,7Z)-5-[tert-butyl(dimethyl)silyl]oxynona-2,7-dienedioate is sourced from PubChem (CID 102597805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).