C35H58O5Si3 — CID 102597806
diethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-bis[dimethyl(phenyl)silyl]nonanedioate (PubChem CID 102597806) has the molecular formula C35H58O5Si3 and a molecular weight of 643.10 g/mol. Its IUPAC name is diethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-bis[dimethyl(phenyl)silyl]nonanedioate.
| Compound Name | diethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-bis[dimethyl(phenyl)silyl]nonanedioate |
|---|---|
| PubChem CID | 102597806 |
| Molecular Formula | C35H58O5Si3 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | diethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-bis[dimethyl(phenyl)silyl]nonanedioate |
| SMILES | CCOC(=O)C[C@H](CC(C[C@@H](CC(=O)OCC)[Si](C)(C)c1ccccc1)O[Si](C)(C)C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C35H58O5Si3/c1-12-38-33(36)26-31(41(6,7)29-20-16-14-17-21-29)24-28(40-43(10,11)35(3,4)5)25-32(27-34(37)39-13-2)42(8,9)30-22-18-15-19-23-30/h14-23,28,31-32H,12-13,24-27H2,1-11H3/t31-,32-/m0/s1 |
| InChIKey | RCFAOZORCDIRIM-ACHIHNKUSA-N |
| XLogP | 8.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|